Ciclonicate |
|
| ATC code | |
|---|
|
trans-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.053.221 |
|---|
|
| Formula | C15H21NO2 |
|---|
| Molar mass | 247.338 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C(O[C@@H]1C[C@@H](C)CC(C)(C)C1)c2cccnc2
|
InChI=1S/C15H21NO2/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h4-6,10-11,13H,7-9H2,1-3H3/t11-,13-/m1/s1 Key:GQSGZTBDVNUIQS-DGCLKSJQSA-N
|
| (verify) |
Ciclonicate is a vasodilator.[1]
References
- ^ Gregoratti L, Crespi B, Groothold G, Fuligni E, Ghiringhelli L (1982). "Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate". Minerva Cardioangiologica. 30 (11): 659–668. PMID 7155375.
|
|---|
| Phenylethanolamine derivatives | |
|---|
| Alpha blockers | |
|---|
| Nicotinic acid and derivatives | |
|---|
| Purine derivatives | |
|---|
| Ergot alkaloids | |
|---|
| Other peripheral vasodilators | |
|---|