Inaperisone |
|
| ATC code | |
|---|
|
1-(4-Ethylphenyl)-2-methyl-3-(1-pyrrolidinyl)-1-propanone
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C16H23NO |
|---|
| Molar mass | 245.366 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCC1=CC=C(C=C1)C(=O)C(C)CN2CCCC2
|
InChI=1S/C16H23NO/c1-3-14-6-8-15(9-7-14)16(18)13(2)12-17-10-4-5-11-17/h6-9,13H,3-5,10-12H2,1-2H3 Key:VNFAARJCGSAROU-UHFFFAOYSA-N
|
Inaperisone (INN) is a muscle relaxant.[1]
See also
Chemically and mechanistically related drugs:
References
- ^ Nagata O, Murata M, Kato H, Terasaki T, Sato H, Tsuji A (1990). "Physiological pharmacokinetics of a new muscle-relaxant, inaperisone, combined with its pharmacological effect on blood flow rate". Drug Metabolism and Disposition. 18 (6): 902–10. PMID 1981535.