Valproate pivoxil |
|
Routes of administration | Oral |
|---|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
[(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.071.502 |
|---|
|
| Formula | C14H26O4 |
|---|
| Molar mass | 258.358 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C(OCOC(=O)C(C)(C)C)C(CCC)CCC
|
InChI=1S/C14H26O4/c1-6-8-11(9-7-2)12(15)17-10-18-13(16)14(3,4)5/h11H,6-10H2,1-5H3 Y Key:DJEFRLDEQKSNLM-UHFFFAOYSA-N Y
|
| NY (what is this?) (verify) |
Valproate pivoxil (Pivadin, Valproxen) is an anticonvulsant used in the treatment of epilepsy.[1] It is the pivaloyloxymethyl ester derivative of valproic acid.[2] It is likely a prodrug of valproic acid, as pivoxil esters are commonly employed to make prodrugs in medicinal chemistry.
See also
References
|
|---|
| Transporter | | GATTooltip GABA transporter | |
|---|
| VIAATTooltip Vesicular inhibitory amino acid transporter | |
|---|
|
|---|
| Enzyme | | GADTooltip Glutamate decarboxylase |
- Inhibitors: 3-Mercaptopropionic acid
- AAOA
- L-Allylglycine
- Semicarbazide
- Activators: 3-Methyl-GABA
|
|---|
| GABA-TTooltip γ-Aminobutyrate aminotransferase |
- Activators: 3-Methyl-GABA
|
|---|
|
|---|
| Other | |
|---|
- See also
- Receptor/signaling modulators
- GABA receptor modulators
- GABAA receptor positive modulators
- Glutamate metabolism/transport modulators
|
|
|---|
|
See also: Receptor/signaling modulators |
|
|---|
| Calcium | | VDCCsTooltip Voltage-dependent calcium channels | |
|---|
|
|---|
| Potassium | | VGKCsTooltip Voltage-gated potassium channels | |
|---|
| IRKsTooltip Inwardly rectifying potassium channel | | Blockers | |
|---|
| Activators |
- GIRKTooltip G protein-coupled inwardly rectifying potassium channel-specific: ML-297 (VU0456810)
|
|---|
|
|---|
| KCaTooltip Calcium-activated potassium channel | |
|---|
| K2PsTooltip Tandem pore domain potassium channel | |
|---|
|
|---|
| Sodium | | VGSCsTooltip Voltage-gated sodium channels | |
|---|
| ENaCTooltip Epithelial sodium channel | |
|---|
| ASICsTooltip Acid-sensing ion channel | |
|---|
|
|---|
| Chloride | | CaCCsTooltip Calcium-activated chloride channel | |
|---|
| CFTRTooltip Cystic fibrosis transmembrane conductance regulator | |
|---|
| Unsorted | |
|---|
|
|---|
| Others | | TRPsTooltip Transient receptor potential channels | |
|---|
| LGICsTooltip Ligand gated ion channels | |
|---|
|
|---|
See also: Receptor/signaling modulators • Transient receptor potential channel modulators |