Efloxate |
|
| ATC code | |
|---|
|
ethyl 2-[(4-oxo-2-phenyl-4H-chromen-7-yl)oxy]acetate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.003.929 |
|---|
|
| Formula | C19H16O5 |
|---|
| Molar mass | 324.332 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCOC(=O)COc1ccc2c(=O)cc(oc2c1)c3ccccc3
|
InChI=1S/C19H16O5/c1-2-22-19(21)12-23-14-8-9-15-16(20)11-17(24-18(15)10-14)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 Key:ZVXBAHLOGZCFTP-UHFFFAOYSA-N
|
| (verify) |
Efloxate is a vasodilator.[1]
References
- ^ Tomasi AM, Masoni A (August 1977). "[Clinical research on the therapeutic efficacy and tolerance of long-acting efloxate in angina pectoris]". La Clinica Terapeutica (in Italian). 82 (3): 227–41. PMID 334448.