Caproxamine |
|
| ATC code | |
|---|
|
5-[(1Z)-N-(2-aminoethoxy)hexanimidoyl]-2-methylaniline
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
|
| Formula | C15H25N3O |
|---|
| Molar mass | 263.385 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O(\N=C(/c1cc(N)c(cc1)C)CCCCC)CCN
|
Caproxamine is a drug which was patented as an antidepressant.[1]
References
- ^ Triggle DJ (1997). Dictionary of pharmacological agents. London: Chapman & Hall. ISBN 0-412-46630-9.
|
|---|
|
|---|
| SSRIsTooltip Selective serotonin reuptake inhibitors | |
|---|
| SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
|---|
| NRIsTooltip Norepinephrine reuptake inhibitors | |
|---|
| NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
|---|
| NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
|---|
| SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
|---|
| SMSTooltip Serotonin modulator and stimulators | |
|---|
| Others | |
|---|
|
|
|
|---|
| TCAsTooltip Tricyclic antidepressants | |
|---|
| TeCAsTooltip Tetracyclic antidepressants | |
|---|
| Others | |
|---|
|
|
|
|---|
| Non-selective | |
|---|
| MAOATooltip Monoamine oxidase A-selective | |
|---|
| MAOBTooltip Monoamine oxidase B-selective | |
|---|
|
|
|
|
|