Benmoxin |
|
Routes of administration | Oral |
|---|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
N'-(1-phenylethyl)benzohydrazide
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.028.745 |
|---|
|
| Formula | C15H16N2O |
|---|
| Molar mass | 240.306 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C(NNC(c1ccccc1)C)c2ccccc2
|
InChI=1S/C15H16N2O/c1-12(13-8-4-2-5-9-13)16-17-15(18)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,17,18) Y Key:BEWNZPMDJIGBED-UHFFFAOYSA-N Y
|
| NY (what is this?) (verify) |
Benmoxin (trade names Neuralex, Nerusil), also known as mebamoxine, is an irreversible and nonselective monoamine oxidase inhibitor (MAOI) of the hydrazine class.[1][2] It was synthesized in 1967 and was subsequently used as an antidepressant in Europe, but is now no longer marketed.[1][2]
See also
References
|
|---|
|
|---|
| SSRIsTooltip Selective serotonin reuptake inhibitors | |
|---|
| SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
|---|
| NRIsTooltip Norepinephrine reuptake inhibitors | |
|---|
| NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
|---|
| NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
|---|
| SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
|---|
| SMSTooltip Serotonin modulator and stimulators | |
|---|
| Others | |
|---|
|
|
|
|---|
| TCAsTooltip Tricyclic antidepressants | |
|---|
| TeCAsTooltip Tetracyclic antidepressants | |
|---|
| Others | |
|---|
|
|
|
|---|
| Non-selective | |
|---|
| MAOATooltip Monoamine oxidase A-selective | |
|---|
| MAOBTooltip Monoamine oxidase B-selective | |
|---|
|
|
|
|
|
|
|---|
| Non-specific | | AAADTooltip Aromatic L-amino acid decarboxylase | |
|---|
| MAOTooltip Monoamine oxidase | |
|---|
|
|---|
Phenethylamines (dopamine, epinephrine, norepinephrine) | | PAHTooltip Phenylalanine hydroxylase |
- Substrates→Products: Phenylalanine→Tyrosine
|
|---|
| THTooltip Tyrosine hydroxylase | |
|---|
| DBHTooltip Dopamine beta-hydroxylase | |
|---|
| PNMTTooltip Phenylethanolamine N-methyltransferase |
- Inhibitors: CGS-19281A
- SKF-64139
- SKF-7698
|
|---|
| COMTTooltip Catechol-O-methyl transferase | |
|---|
|
|---|
Tryptamines (serotonin, melatonin) | | TPHTooltip Tryptophan hydroxylase |
- Substrates→Products: Tryptophan→5-HTP
|
|---|
| AANATTooltip Serotonin N-acetyl transferase | |
|---|
| ASMTTooltip Acetylserotonin O-methyltransferase | |
|---|
|
|---|
| Histamine | | HDCTooltip Histidine decarboxylase |
- Substrates→Products: L-Histidine→Histamine
|
|---|
| HNMTTooltip Histamine N-methyltransferase |
- Substrates→Products: Histamine→N-Methylhistamine
|
|---|
| DAOTooltip Diamine oxidase |
- Substrates→Products: Histamine→Imidazole acetic acid
|
|---|
|
|---|
See also: Receptor/signaling modulators • Adrenergics • Dopaminergics • Melatonergics • Serotonergics • Monoamine reuptake inhibitors • Monoamine releasing agents • Monoamine neurotoxins |