Immethridine
|
|
| Names
|
Preferred IUPAC name
4-[(1H-Imidazol-5-yl)methyl]pyridine
|
| Identifiers
|
CAS Number
|
|
3D model (JSmol)
|
|
| ChEMBL
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.163.679
|
|
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C9H9N3/c1-3-10-4-2-8(1)5-9-6-11-7-12-9/h1-4,6-7H,5H2,(H,11,12) N Key: DFVSGZHJSIEEQQ-UHFFFAOYSA-N N InChI=1/C9H9N3/c1-3-10-4-2-8(1)5-9-6-11-7-12-9/h1-4,6-7H,5H2,(H,11,12) Key: DFVSGZHJSIEEQQ-UHFFFAOYAF
|
|
|
| Properties
|
Chemical formula
|
C9H9N3
|
| Molar mass
|
159.188 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Immethridine is a histamine agonist selective for the H3 subtype.[1]
References
- ^ Kitbunnadaj, R; Zuiderveld, OP; Christophe, B; Hulscher, S; Menge, WM; Gelens, E; Snip, E; Bakker, RA; et al. (2004). "Identification of 4-(1H-imidazol-4(5)-ylmethyl)pyridine (immethridine) as a novel, potent, and highly selective histamine H(3) receptor agonist". Journal of Medicinal Chemistry. 47 (10): 2414–7. doi:10.1021/jm049932u. PMID 15115383.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | | Agonists |
- 4-Methylhistamine
- α-Methylhistamine
- Histamine
- L-Histidine
- OUP-16
- VUF-8430
|
|---|
| Antagonists | |
|---|
|
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|