Cimoxatone |
|
| ATC code | |
|---|
|
3-[[4-[5-(methoxymethyl)-2-oxo-oxazolidin-3-yl]phenoxy]methyl]benzonitrile
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.070.537 |
|---|
|
| Formula | C19H18N2O4 |
|---|
| Molar mass | 338.363 g·mol−1 |
|---|
InChI=1S/C19H18N2O4/c1-23-13-18-11-21(19(22)25-18)16-5-7-17(8-6-16)24-12-15-4-2-3-14(9-15)10-20/h2-9,18H,11-13H2,1H3 Y Key:MVVJINIUPYKZHR-UHFFFAOYSA-N Y
|
| NY (what is this?) (verify) |
Cimoxatone (MD 780515) is a reversible inhibitor of MAO-A (RIMA).[1] It was never marketed.
Cimoxatone has a half-life of 12.4 hours in humans.[2]
See also
References
|
|---|
|
|---|
| SSRIsTooltip Selective serotonin reuptake inhibitors | |
|---|
| SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
|---|
| NRIsTooltip Norepinephrine reuptake inhibitors | |
|---|
| NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
|---|
| NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
|---|
| SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
|---|
| SMSTooltip Serotonin modulator and stimulators | |
|---|
| Others | |
|---|
|
|
|
|---|
| TCAsTooltip Tricyclic antidepressants | |
|---|
| TeCAsTooltip Tetracyclic antidepressants | |
|---|
| Others | |
|---|
|
|
|
|---|
| Non-selective | |
|---|
| MAOATooltip Monoamine oxidase A-selective | |
|---|
| MAOBTooltip Monoamine oxidase B-selective | |
|---|
|
|
|
|
|
|
|---|
| Non-specific | | AAADTooltip Aromatic L-amino acid decarboxylase | |
|---|
| MAOTooltip Monoamine oxidase | |
|---|
|
|---|
Phenethylamines (dopamine, epinephrine, norepinephrine) | | PAHTooltip Phenylalanine hydroxylase |
- Substrates→Products: Phenylalanine→Tyrosine
|
|---|
| THTooltip Tyrosine hydroxylase | |
|---|
| DBHTooltip Dopamine beta-hydroxylase | |
|---|
| PNMTTooltip Phenylethanolamine N-methyltransferase |
- Inhibitors: CGS-19281A
- SKF-64139
- SKF-7698
|
|---|
| COMTTooltip Catechol-O-methyl transferase | |
|---|
|
|---|
Tryptamines (serotonin, melatonin) | | TPHTooltip Tryptophan hydroxylase |
- Substrates→Products: Tryptophan→5-HTP
|
|---|
| AANATTooltip Serotonin N-acetyl transferase | |
|---|
| ASMTTooltip Acetylserotonin O-methyltransferase | |
|---|
|
|---|
| Histamine | | HDCTooltip Histidine decarboxylase |
- Substrates→Products: L-Histidine→Histamine
|
|---|
| HNMTTooltip Histamine N-methyltransferase |
- Substrates→Products: Histamine→N-Methylhistamine
|
|---|
| DAOTooltip Diamine oxidase |
- Substrates→Products: Histamine→Imidazole acetic acid
|
|---|
|
|---|
See also: Receptor/signaling modulators • Adrenergics • Dopaminergics • Melatonergics • Serotonergics • Monoamine reuptake inhibitors • Monoamine releasing agents • Monoamine neurotoxins |